Chemical Compounds
Compounds
get information about a chemical compound
octane
H2SO4
eicosapentaenoic acid
dopamine
specify a compound by chemical identifier
InChI=1/C8H8O3/c1-11-8-4-6(5-9)2-3-7(8)10/h2-5,10H,1H3
CAS 287-23-0
compare several compounds
methanol, ethanol, isopropanol
Properties of Compounds
request a property of a chemical compound
benzene viscosity
combustion heat of C3H8
enthalpy of hydration of acetic acid
energy content of H2
3-amino-4-chlorobenzoic acid molecular properties
compare properties of multiple compounds
flash point methane, butane, octane
do computations with chemical properties
viscosity glycerol / methanol
compute a property at a specified temperature
surface tension of hexadecane at 25C
electrical resistivity of gold at 10K
vapor pressure of BaCl2 at 10C
find a threshold limit value
tlv of pentane
find speed of sound in a chemical
How fast does sound travel in chloroform?
find a UV cutoff wavelength for a chemical
benzene absorbs light up to what wavelength
look up an identifier for a compound
InChI for isobutyl alcohol
Classes of Compounds
get information about a class of compounds
alkyne
analyze properties of a class of compounds